RefMet Compound Details
MW structure | 34388 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 7-Dehydrocholesterol | |
Systematic name | cholesta-5,7-dien-3beta-ol | |
SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:2;O | View other entries in RefMet with this sum composition |
Exact mass | 384.339215 (neutral) |
Table of KEGG reactions in human pathways involving 7-Dehydrocholesterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07215 | Lathosterol + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> 7-Dehydrocholesterol + 2 Ferricytochrome b5 + 2 H2O | lathosterol,ferrocytochrome b5:oxygen oxidoreductase 5,6-dehydrogenating |
R01451 | Cholesterol + NAD+ <=> 7-Dehydrocholesterol + NADH + H+ | Cholesterol:NAD+ delta7-oxidoreductase |
R01456 | Cholesterol + NADP+ <=> 7-Dehydrocholesterol + NADPH + H+ | cholesterol:NADP+ delta7-oxidoreductase |
R07507 | 7-Dehydrodesmosterol + NADPH + H+ <=> 7-Dehydrocholesterol + NADP+ | 7-Dehydrodesmosterol + NADPH + H+ <=> 7-Dehydrocholesterol + NADP+ |
Table of KEGG human pathways containing 7-Dehydrocholesterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 4 |
hsa01100 | Metabolic pathways | 2 |