RefMet Compound Details
MW structure | 37035 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Biotin | |
Systematic name | 5-[(3aS,4S,6aR)-2-oxo-hexahydro-1H-thieno[3,4-d]imidazolidin-4-yl]pentanoic acid | |
SMILES | C(CCC(=O)O)C[C@H]1[C@@H]2[C@H](CS1)NC(=O)N2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 244.088165 (neutral) |
Table of KEGG reactions in human pathways involving Biotin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01074 | ATP + Biotin <=> Diphosphate + Biotinyl-5'-AMP | biotin:CoA ligase (AMP-forming) |
Table of KEGG human pathways containing Biotin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00780 | Biotin metabolism | 2 |