RefMet Compound Details
MW structure | 35325 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Dehydroepiandrosterone | |
Systematic name | 3beta-hydroxyandrost-5-en-17-one | |
SMILES | C[C@]12CC[C@@H](CC1=CC[C@H]1[C@@H]3CCC(=O)[C@@]3(C)CC[C@H]21)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 19:2;O2 | View other entries in RefMet with this sum composition |
Exact mass | 288.208930 (neutral) |
Table of KEGG reactions in human pathways involving Dehydroepiandrosterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03404 | Dehydroepiandrosterone sulfate + H2O <=> Dehydroepiandrosterone + Sulfate | 3beta-Hydroxyandrost-5-en-17-one 3-sulfate sulfohydrolase |
R08517 | 17alpha-Hydroxypregnenolone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Dehydroepiandrosterone + Acetate + [Oxidized NADPH---hemoprotein reductase] + H2O | 17alpha-Hydroxypregnenolone,NADPH---hemoprotein reductase:oxygen oxidoreductase (17alpha-hydroxylating, acetate-releasing) |
R03406 | Androstenediol + NAD+ <=> Dehydroepiandrosterone + NADH + H+ | Androst-5-ene-3beta,17beta-diol:NAD+ oxidoreductase |
R01837 | Dehydroepiandrosterone + NAD+ <=> Androstenedione + NADH + H+ | 3beta-Hydroxyandrost-5-en-17-one:NAD+ 3-oxidoreductase/delta5-delta-4 isomerase |
R03405 | 3'-Phosphoadenylyl sulfate + Dehydroepiandrosterone <=> Adenosine 3',5'-bisphosphate + Dehydroepiandrosterone sulfate | 3'-phosphoadenylylsulfate:alcohol sulfotransferase |
R03408 | Dehydroepiandrosterone + H+ + Oxygen + NADPH <=> 16alpha-Hydroxydehydroepiandrosterone + NADP+ + H2O | Dehydroepiandrosterone + H+ + Oxygen + NADPH <=> 16alpha-Hydroxydehydroepiandrosterone + NADP+ + H2O |
R03407 | Androstenediol + NADP+ <=> Dehydroepiandrosterone + NADPH + H+ | Androst-5-ene-3beta,17beta-diol:NADP+ oxidoreductase |
R08961 | Dehydroepiandrosterone + Oxygen + [Reduced NADPH---hemoprotein reductase] <=> 7alpha-Hydroxydehydroepiandrosterone + [Oxidized NADPH---hemoprotein reductase] + H2O | dehydroepiandrosterone,NADPH-hemoprotein reductase:oxygen oxidoreductase (7alpha-hydroxylating) |
Table of KEGG human pathways containing Dehydroepiandrosterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 8 |