RefMet Compound Details
MW structure | 36974 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Glycocholic acid | |
Alternative name | Gly-CA | |
Systematic name | N-(3alpha,7alpha,12alpha-trihydroxy-5beta-cholan-24-oyl)-glycine | |
SMILES | C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@@H]([C@]12C)O)[C@@]1(C)CC[C@H](C[C@H]1C[C@H]3O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 24:1;O5;G | View other entries in RefMet with this sum composition |
Exact mass | 465.309039 (neutral) |
Table of KEGG reactions in human pathways involving Glycocholic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03718 | Choloyl-CoA + Glycine <=> CoA + Glycocholate | Choloyl-CoA:glycine N-choloyltransferase |
Table of KEGG human pathways containing Glycocholic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00120 | Primary bile acid biosynthesis | 1 |