RefMet Compound Details
MW structure | 41318 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | LPE 0:0/18:1(11Z) | |
SMILES | CCCCCC/C=C\CCCCCCCCCC(=O)O[C@H](CO)COP(=O)(O)OCCN Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 479.3012 (neutral) |
Table of KEGG reactions in human pathways involving LPE 0:0/18:1(11Z)
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04480 | Phosphatidylethanolamine + CoA <=> 1-Acyl-sn-glycero-3-phosphoethanolamine + Acyl-CoA | Acyl-CoA:1-acyl-sn-glycero-3-phosphoethanolamine O-acyltransferase |
R03416 | 1-Acyl-sn-glycero-3-phosphoethanolamine + H2O <=> Fatty acid + sn-Glycero-3-phosphoethanolamine | 1-Acyl-sn-glycero-3-phosphoethanolamine aldehydohydrolase |
R02053 | Phosphatidylethanolamine + H2O <=> 1-Acyl-sn-glycero-3-phosphoethanolamine + Fatty acid | phosphatidylethanolamine 2-acylhydrolase |
Table of KEGG human pathways containing LPE 0:0/18:1(11Z)
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00564 | Glycerophospholipid metabolism | 3 |