RefMet Compound Details
MW structure | 2581 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | LTA4 | |
Systematic name | 5S,6S-epoxy-7E,9E,11Z,14Z-eicosatetraenoic acid | |
SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@H]1[C@H](CCCC(=O)O)O1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 318.219495 (neutral) |
Table of KEGG reactions in human pathways involving LTA4
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03057 | Leukotriene A4 + H2O <=> Leukotriene B4 | (7E,9E,11Z,14Z)-(5S,6S)-5,6-Epoxyicosa-7,9,11,14-tetraenoate hydrolase |
R03058 | 5(S)-HPETE <=> Leukotriene A4 + H2O | arachidonate:oxygen 5-oxidoreductase |
R03059 | Leukotriene A4 + Glutathione <=> Leukotriene C4 | (7E,9E,11Z,14Z)-(5S,6S)-5,6-Epoxyicosa-7,9,11,14-tetraenoate:glutathione leukotriene-transferase (epoxide-ring-opening) |
Table of KEGG human pathways containing LTA4
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 3 |