RefMet Compound Details
MW structure | 39035 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Melibiitol | |
Systematic name | 6-O-(1-deoxy-D-glucitol-1-yl)-alpha-D-galactopyranose | |
SMILES | C([C@H]([C@H]([C@@H]([C@H](COC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O)O1)O)O)O)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 344.131865 (neutral) |
Table of KEGG reactions in human pathways involving Melibiitol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02926 | Melibiitol + H2O <=> D-Sorbitol + D-Galactose | Melibiitol galactohydrolase |
Table of KEGG human pathways containing Melibiitol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00052 | Galactose metabolism | 1 |