RefMet Compound Details
MW structure | 37729 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | N-6-Trimethyllysine | |
Systematic name | (2S)-2-amino-6-(trimethylazaniumyl)hexanoate | |
SMILES | C[N+](C)(C)CCCC[C@@H](C(=O)[O-])N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 188.152478 (neutral) |
Table of KEGG reactions in human pathways involving N-6-Trimethyllysine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03451 | N6,N6,N6-Trimethyl-L-lysine + 2-Oxoglutarate + Oxygen <=> (3S)-3-Hydroxy-N6,N6,N6-trimethyl-L-lysine + Succinate + CO2 | N6,N6,N6-Trimethyl-L-lysine,2-oxoglutarate:oxygen oxidoreductase (3-hydroxylating) |
Table of KEGG human pathways containing N-6-Trimethyllysine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00310 | Lysine degradation | 1 |