RefMet Compound Details
MW structure | 37676 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | N-Acetylserotonin | |
Systematic name | N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]acetamide | |
SMILES | CC(=O)NCCc1c[nH]c2ccc(cc12)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 218.105528 (neutral) |
Table of KEGG reactions in human pathways involving N-Acetylserotonin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03130 | S-Adenosyl-L-methionine + N-Acetylserotonin <=> S-Adenosyl-L-homocysteine + Melatonin | S-Adenosyl-L-homocysteine:N-acetylserotonin O-methyltransferase |
R02911 | Acetyl-CoA + Serotonin <=> CoA + N-Acetylserotonin | acetyl-CoA:aralkylamine N-acetyltransferase |
Table of KEGG human pathways containing N-Acetylserotonin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 2 |