RefMet Compound Details
MW structure | 21188 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | PA 19:1(9Z)/0:0 | |
SMILES | CCCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 464.2539 (neutral) |
Table of KEGG reactions in human pathways involving PA 19:1(9Z)/0:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02051 | Phosphatidylethanolamine + H2O <=> Ethanolamine + Phosphatidate | phosphatidylethanolamine phosphatidohydrolase |
R02240 | ATP + 1,2-Diacyl-sn-glycerol <=> ADP + Phosphatidate | ATP:1,2-diacylglycerol 3-phosphotransferase |
R09944 | CTP + 1,2-Diacyl-sn-glycerol <=> CDP + Phosphatidate | CTP:1,2-diacyl-sn-glycerol 3-phosphotransferase |
R02239 | Phosphatidate + H2O <=> 1,2-Diacyl-sn-glycerol + Orthophosphate | 1,2-diacyl-sn-glycerol 3-phosphate phosphohydrolase |
R02241 | Phosphatidate + CoA <=> 1-Acyl-sn-glycerol 3-phosphate + Acyl-CoA | acyl-CoA:1-acyl-sn-glycerol-3-phosphate 2-O-acyltransferase |
R01799 | CTP + Phosphatidate <=> Diphosphate + CDP-diacylglycerol | CTP:phosphatidate cytidyltransferase |
R01310 | Phosphatidylcholine + H2O <=> Phosphatidate + Choline | phosphatidylcholine phosphatidohydrolase |
Table of KEGG human pathways containing PA 19:1(9Z)/0:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00564 | Glycerophospholipid metabolism | 6 |
hsa00561 | Glycerolipid metabolism | 3 |
hsa04070 | Phosphatidylinositol signaling system | 2 |
hsa01100 | Metabolic pathways | 1 |