RefMet Compound Details
MW structure | 29025 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Retinol | |
Systematic name | Retinol | |
SMILES | C/C(=C\C=C\C(=C\CO)\C)/C=C/C1=C(C)CCCC1(C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 286.229665 (neutral) |
Table of KEGG reactions in human pathways involving Retinol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02124 | Retinol + NAD+ <=> Retinal + NADH + H+ | retinol:NAD+ oxidoreductase |
R11952 | Retinol + 2 Reduced adrenal ferredoxin + 2 H+ + Oxygen <=> all-trans-3,4-Didehydroretinol + 2 Oxidized adrenal ferredoxin + 2 H2O | all-trans-retinol,reduced adrenodoxin:oxygen 3,4-oxidoreductase |
R02368 | Retinyl palmitate + H2O <=> Retinol + Hexadecanoic acid | retinyl-palmitate palmitohydrolase |
R08387 | Phosphatidylcholine + Retinol <=> 2-Acyl-sn-glycero-3-phosphocholine + Retinyl ester | phosphatidylcholine:retinol O-acyltransferase |
R08379 | Retinol + NADP+ <=> Retinal + NADPH + H+ | retinol: NADP+ oxidoreductase |
R07163 | all-trans-13,14-Dihydroretinol + Acceptor <=> Retinol + Reduced acceptor | all-trans-13,14-dihydroretinol:acceptor 13,14-oxidoreductas |
Table of KEGG human pathways containing Retinol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00830 | Retinol metabolism | 6 |
hsa01100 | Metabolic pathways | 1 |
hsa01240 | Biosynthesis of cofactors | 1 |