RefMet Compound Details
MW structure | 37153 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Sepiapterin | |
Systematic name | 2-amino-6-[(2S)-2-hydroxypropanoyl]-1,4,7,8-tetrahydropteridin-4-one | |
SMILES | C[C@@H](C(=O)C1=Nc2c(NC1)[nH]c(N)nc2=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 237.086190 (neutral) |
Table of KEGG reactions in human pathways involving Sepiapterin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02975 | 7,8-Dihydrobiopterin + NADP+ <=> Sepiapterin + NADPH + H+ | 7,8-Dihydrobiopterin:NADP+ oxidoreductase |
Table of KEGG human pathways containing Sepiapterin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00790 | Folate biosynthesis | 1 |