RefMet Compound Details
MW structure | 38188 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Thiamine monophosphate | |
Systematic name | 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-[2-(hydrogen phosphonatooxy)ethyl]-4-methyl-1,3-thiazol-3-ium | |
SMILES | Cc1c(CCOP(=O)(O)[O-])sc[n+]1Cc1cnc(C)nc1N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 344.070816 (neutral) |
Table of KEGG reactions in human pathways involving Thiamine monophosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00615 | Thiamin diphosphate + H2O <=> Thiamin monophosphate + Orthophosphate | Thiamin diphosphate phosphohydrolase |
R00617 | ATP + Thiamin monophosphate <=> ADP + Thiamin diphosphate | ATP:thiamin-phosphate phosphotransferase |
R02134 | ATP + Thiamine <=> ADP + Thiamin monophosphate | ATP:thiamine phosphotransferase |
R02135 | Thiamin monophosphate + H2O <=> Thiamine + Orthophosphate | thiamin monophosphate phosphohydrolase |
Table of KEGG human pathways containing Thiamine monophosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00730 | Thiamine metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |