Metabolomics Structure Database
|
|
| MW REGNO: | 41894 |
| Common Name: | 5-Methyltetrahydropteroyltri-L-glutamate |
| Systematic Name: | (2S)-2-[(4S)-4-[(4S)-4-{[4-({[(6S)-2-amino-5-methyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)phenyl]formamido}-4-carboxybutanamido]-4-carboxybutanamido]pentanedioic acid |
| RefMet Name: | 5-Methyltetrahydropteroyltri-L-glutamate |
| Synonyms: | [PubChem Synonyms] |
| Exact Mass: | |
| Formula: | C30H39N9O12 |
| InChIKey: | HVRNKDVLFAVCJF-VJANTYMQSA-N |
| ClassyFire superclass: | Organoheterocyclic compounds [C0000002] |
| ClassyFire class: | Pteridines and derivatives [C0000109] |
| ClassyFire subclass: | Pterins and derivatives [C0000110] |
| ClassyFire direct parent: | Tetrahydrofolic acids and derivatives [C0002618] |
| SMILES: | CN1[C@@H](CNc2ccc(cc2)C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)CNc2c1c(=O)[nH]c(N)n2 |
| Studies: | Available studies (via RefMet name) |
Select appropriate tab below to view additional details:
External database links:
| PubChem CID: | 135398574 |
| CHEBI ID: | 63907 |
| HMDB ID: | HMDB0012177 |
| KEGG ID: | C04489 |
| Chemspider ID: | 17625689 |
| MetaCyc ID: | CPD-1302 |
| Plant Metabolite Hub(Pmhub): | MS000018367 |
References
LIPID MAPS classification: "Update of the LIPID MAPS comprehensive classification system for lipids", Fahy E, Subramaniam S, Murphy RC, Nishijima M, Raetz CR, Shimizu T, Spener F, van Meer G, Wakelam MJ, and Dennis EA, J. Lipid Res. (2009) 50: S9-S14. DOI: 10.1194/jlr.R800095-JLR200 ClassyFire classification: "ClassyFire: automated chemical classification with a comprehensive, computable taxonomy", Djoumbou Feunang Y, Eisner R, Knox C, Chepelev L, Hastings J, Owen G, Fahy E, Steinbeck C, Subramanian S, Bolton E, Greiner R, and Wishart DS, J. Cheminformatics (2016) 8:61. DOI: 10.1186/s13321-016-0174-y
