RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0118180 | |
---|---|---|
RefMet name | 1-Pyrroline-2-carboxylic acid | |
Systematic name | 3,4-dihydro-2H-pyrrole-5-carboxylic acid | |
Synonyms | PubChem Synonyms | |
Exact mass | 113.047679 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C5H7NO2 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 39080 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h1-3H2,(H,7,8) | |
InChIKey | RHTAIKJZSXNELN-UHFFFAOYSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | C1CC(=NC1)C(=O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Organoheterocyclic compounds | |
Main Class | Pyrrolines | |
Sub Class | Pyrrolines | |
Distribution of 1-Pyrroline-2-carboxylic acid in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting 1-Pyrroline-2-carboxylic acid | |
External Links | ||
Pubchem CID | 440046 | |
ChEBI ID | 36761 | |
KEGG ID | C03564 | |
HMDB ID | HMDB0006875 | |
Chemspider ID | 389057 | |
MetaCyc ID | DELTA1-PYRROLINE_2-CARBOXYLATE | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving 1-Pyrroline-2-carboxylic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02894 | D-Proline + Oxygen <=> 1-Pyrroline-2-carboxylate + Hydrogen peroxide | D-Proline:oxygen oxidoreductase |
R04374 | trans-3-Hydroxy-L-proline <=> 1-Pyrroline-2-carboxylate + H2O | trans-3-hydroxy-L-proline hydro-lyase (1-pyrroline-2-carboxylate-forming) |
R09496 | D-Proline + Acceptor <=> 1-Pyrroline-2-carboxylate + Reduced acceptor | D-proline:acceptor oxidoreductase |
Table of KEGG human pathways containing 1-Pyrroline-2-carboxylic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00330 | Arginine and proline metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |