RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0136082 | |
---|---|---|
RefMet name | Coproporphyrinogen III | |
Systematic name | 3-[9,14,20-tris(2-carboxyethyl)-5,10,15,19-tetramethyl-21,22,23,24-tetraazapentacyclo[16.2.1.1^{3,6}.1^{8,11}.1^{13,16}]tetracosa-1(20),3,5,8,10,13,15,18-octaen-4-yl]propanoic acid | |
Synonyms | PubChem Synonyms | |
Exact mass | 660.315914 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C36H44N4O8 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 37689 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C36H44N4O8/c1-17-21(5-9-33(41)42)29-14-27-19(3)22(6-10-34(43)44)30(39-27)15-28-20(4)24(8-12-36(47)48)32(40-28)16-31-23(7- 11-35(45)46)18(2)26(38-31)13-25(17)37-29/h37-40H,5-16H2,1-4H3,(H,41,42)(H,43,44)(H,45,46)(H,47,48) | |
InChIKey | NIUVHXTXUXOFEB-UHFFFAOYSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | Cc1c(CCC(=O)O)c2Cc3c(C)c(CCC(=O)O)c(Cc4c(C)c(CCC(=O)O)c(Cc5c(CCC(=O)O)c(C)c(Cc1[nH]2)[nH]5)[nH]4)[nH]3
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Organoheterocyclic compounds | |
Main Class | Porphyrins | |
Sub Class | Porphyrins | |
Distribution of Coproporphyrinogen III in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Coproporphyrinogen III | |
External Links | ||
Pubchem CID | 321 | |
ChEBI ID | 15439 | |
KEGG ID | C03263 | |
HMDB ID | HMDB0001261 | |
Chemspider ID | 315 | |
MetaCyc ID | COPROPORPHYRINOGEN_III | |
EPA CompTox | DTXCID80103366 | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Coproporphyrinogen III
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03197 | Uroporphyrinogen III <=> Coproporphyrinogen III + 4 CO2 | Uroporphyrinogen-III carboxy-lyase |
R03220 | Coproporphyrinogen III + Oxygen <=> Protoporphyrinogen IX + 2 CO2 + 2 H2O | Coproporphyrinogen:oxygen oxidoreductase(decarboxylating) |
R04178 | Coproporphyrinogen III + 3 Oxygen <=> Coproporphyrin III + 3 Hydrogen peroxide | coproporphyrinogen-III:oxygen oxidoreductase (coproporphyrin-forming) |
R06895 | Coproporphyrinogen III + 2 S-Adenosyl-L-methionine <=> Protoporphyrinogen IX + 2 CO2 + 2 L-Methionine + 2 5'-Deoxyadenosine | coproporphyrinogen-III:S-adenosyl-L-methionine oxidoreductase(decarboxylating) |
Table of KEGG human pathways containing Coproporphyrinogen III
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00860 | Porphyrin and chlorophyll metabolism | 3 |
hsa01100 | Metabolic pathways | 1 |
hsa01240 | Biosynthesis of cofactors | 1 |