RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0136810 | |
---|---|---|
RefMet name | Biliverdin | |
Systematic name | biliverdin | |
Synonyms | PubChem Synonyms | |
Exact mass | 582.247836 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C33H34N4O6 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 50741 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C33H34N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-1 6(3)21(8-2)33(43)36-26/h7-8,13-15,35H,1-2,9-12H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b26-13-,27-14-,28-15- | |
InChIKey | QBUVFDKTZJNUPP-BBROENKCSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | C=CC1=C(C)C(=O)N/C/1=C\c1c(C)c(CCC(=O)O)c(/C=C\2/C(=C(C)C(=N2)/C=C\2/C(=C(C=C)C(=O)N2)C)CCC(=O)O)[nH]1
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Organoheterocyclic compounds | |
Main Class | Bilirubins | |
Sub Class | Bilirubins | |
Distribution of Biliverdin in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Biliverdin | |
External Links | ||
Pubchem CID | 5280353 | |
ChEBI ID | 17033 | |
KEGG ID | C00500 | |
HMDB ID | HMDB0001008 | |
Spectral data for Biliverdin standards | ||
MassBank(EU) | View MS spectra | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Biliverdin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00311 | Heme + 3 [Reduced NADPH---hemoprotein reductase] + 3 Oxygen <=> Biliverdin + CO + Fe2+ + 3 [Oxidized NADPH---hemoprotein reductase] + 3 H2O | protoheme,NADPH---hemoprotein reductase:oxygen oxidoreductase (alpha-methene-oxidizing, hydroxylating) |
R02391 | Bilirubin + NAD+ <=> Biliverdin + NADH + H+ | Bilirubin:NAD+ oxidoreductase |
R02393 | Bilirubin + NADP+ <=> Biliverdin + NADPH + H+ | Bilirubin:NADP+ oxidoreductase |
R11579 | Heme + 6 Reduced ferredoxin + 3 Oxygen + 6 H+ <=> Biliverdin + Fe2+ + CO + 6 Oxidized ferredoxin + 3 H2O | protoheme,reduced ferredoxin:oxygen oxidoreductase (alpha-methene-oxidizing, hydroxylating) |
R12481 | Bilirubin + Oxidised coenzyme F420-(gamma-Glu)n <=> Biliverdin + Reduced coenzyme F420-(gamma-Glu)n | Bilirubin + Oxidised coenzyme F420-(gamma-Glu)n <=> Biliverdin + Reduced coenzyme F420-(gamma-Glu)n |
Table of KEGG human pathways containing Biliverdin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 4 |
hsa00860 | Porphyrin metabolism | 2 |
hsa00860 | Porphyrin and chlorophyll metabolism | 1 |