RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0153689 | |
---|---|---|
RefMet name | 4-Aminopentanoic acid | |
Alternative name | 4-Aminobutyric acid | |
Systematic name | 4-amino-pentanoic acid | |
Synonyms | PubChem Synonyms | |
Exact mass | 117.078979 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C5H11NO2 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 1856 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C5H11NO2/c1-4(6)2-3-5(7)8/h4H,2-3,6H2,1H3,(H,7,8) | |
InChIKey | ABSTXSZPGHDTAF-UHFFFAOYSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | CC(CCC(=O)O)N
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Fatty Acyls | |
Main Class | Fatty acids | |
Sub Class | Amino FA | |
Distribution of 4-Aminopentanoic acid in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting 4-Aminopentanoic acid | |
External Links | ||
Pubchem CID | 223130 | |
LIPID MAPS | LMFA01100023 | |
ChEBI ID | 178408 | |
KEGG ID | C00334 | |
Structural annotation level | ||
Annotation level | 2 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving 4-Aminopentanoic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00261 | L-Glutamate <=> 4-Aminobutanoate + CO2 | L-glutamate 1-carboxy-lyase (4-aminobutanoate-forming) |
R01648 | 4-Aminobutanoate + 2-Oxoglutarate <=> Succinate semialdehyde + L-Glutamate | 4-aminobutanoate:2-oxoglutarate aminotransferase |
R01986 | 4-Aminobutyraldehyde + NADP+ + H2O <=> 4-Aminobutanoate + NADPH + H+ | 4-Aminobutyraldehyde:NAD+ oxidoreductase |
R01989 | L-Arginine + 4-Aminobutanoate <=> L-Ornithine + 4-Guanidinobutanoate | L-Arginine:4-aminobutanoate amidinotransferase |
R01990 | 4-Guanidinobutanoate + H2O <=> 4-Aminobutanoate + Urea | 4-Guanidinobutanoate amidinohydrolase |
R01991 | ATP + L-Histidine + 4-Aminobutanoate <=> ADP + Orthophosphate + Homocarnosine | L-histidine:4-aminobutanoate ligase (ADP-forming) |
R01992 | Homocarnosine + H2O <=> 4-Aminobutanoate + L-Histidine | alpha-Aminobutyryl histidine hydrolase |
R02549 | 4-Aminobutyraldehyde + NAD+ + H2O <=> 4-Aminobutanoate + NADH + H+ | 4-aminobutanal:NAD+ 1-oxidoreductase |
R10178 | 4-Aminobutanoate + Pyruvate <=> Succinate semialdehyde + L-Alanine | 4-aminobutanoate:pyruvate aminotransferase |
Table of KEGG human pathways containing 4-Aminopentanoic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00330 | Arginine and proline metabolism | 5 |
hsa01100 | Metabolic pathways | 4 |
hsa00250 | Alanine, aspartate and glutamate metabolism | 2 |
hsa00650 | Butanoate metabolism | 2 |