RefMet Compound Details
MW structure | 28207 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | (2-trans,6-trans)-Farnesal | |
Systematic name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienal | |
SMILES | CC(=CCC/C(=C/CC/C(=C/C=O)/C)/C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 220.182715 (neutral) |
Table of KEGG reactions in human pathways involving (2-trans,6-trans)-Farnesal
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R09562 | Farnesylcysteine + Oxygen + H2O <=> 2-trans,6-trans-Farnesal + L-Cysteine + Hydrogen peroxide | S-(2E,6E)-farnesyl-L-cysteine oxidase |
Table of KEGG human pathways containing (2-trans,6-trans)-Farnesal
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00900 | Terpenoid backbone biosynthesis | 1 |