RefMet Compound Details
MW structure | 28718 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | (S)-2,3-Epoxysqualene | |
Systematic name | (3S)-2,2-dimethyl-3-[(3Z,7E,11Z,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaen-1-yl]oxirane | |
SMILES | CC(=CCC/C(=C/CC/C(=C/CC/C=C(\C)/CC/C=C(\C)/CC[C@H]1C(C)(C)O1)/C)/C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 426.386165 (neutral) |
Table of KEGG reactions in human pathways involving (S)-2,3-Epoxysqualene
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03199 | (S)-2,3-Epoxysqualene <=> Lanosterol | (S)-2,3-Epoxysqualene mutase (cyclizing, lanosterol-forming) |
R12355 | Squalene + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> (S)-2,3-Epoxysqualene + 2 Ferricytochrome b5 + H2O | Squalene + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> (S)-2,3-Epoxysqualene + 2 Ferricytochrome b5 + H2O |
R02874 | Squalene + Oxygen + [Reduced NADPH---hemoprotein reductase] <=> (S)-2,3-Epoxysqualene + [Oxidized NADPH---hemoprotein reductase] + H2O | squalene,NADPH-hemoprotein:oxygen oxidoreductase (2,3-epoxidizing) |
Table of KEGG human pathways containing (S)-2,3-Epoxysqualene
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 2 |
hsa01100 | Metabolic pathways | 1 |