RefMet Compound Details
MW structure | 2761 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 11,12-Ep-15S-HETrE | |
Systematic name | 11,12-epoxy-15S-hydroxy-5Z,8Z,13E-eicosatrienoic acid | |
SMILES | CCCCC[C@@H](/C=C/C1C(C/C=C\C/C=C\CCCC(=O)O)O1)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 336.230060 (neutral) |
Table of KEGG reactions in human pathways involving 11,12-Ep-15S-HETrE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07042 | 15(S)-HPETE <=> 15H-11,12-EETA | 15(S)-HPETE <=> 15H-11,12-EETA |
R07044 | 15H-11,12-EETA + H2O <=> 11,12,15-THETA | 15H-11,12-EETA + H2O <=> 11,12,15-THETA |
Table of KEGG human pathways containing 11,12-Ep-15S-HETrE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 2 |