RefMet Compound Details
RefMet ID | RM0159099 | |
---|---|---|
MW structure | 87212 (View MW Metabolite Database details) | |
RefMet name | 11-Hydroxytestosterone | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@@H]([C@@]3(C)CC([C@H]21)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 304.203845 (neutral) |
Table of KEGG reactions in human pathways involving 11-Hydroxytestosterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08945 | 11beta,17beta-Dihydroxy-4-androsten-3-one + NAD+ <=> 11beta-Hydroxyandrost-4-ene-3,17-dione + NADH + H+ | 11beta,17beta-dihydroxy-4-androsten-3-one:NAD+ 17-oxidoreductase |
R08980 | 11beta,17beta-Dihydroxy-4-androsten-3-one + NADP+ <=> 11beta-Hydroxyandrost-4-ene-3,17-dione + NADPH + H+ | 11beta,17beta-dihydroxy-4-androsten-3-one:NADP+ 17-oxidoreductase |
Table of KEGG human pathways containing 11-Hydroxytestosterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |