RefMet Compound Details
MW structure | 66829 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 11Z-Eicosenoyl-CoA | |
Alternative name | CoA 20:1(11Z) | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[(11Z)-icos-11-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 20:1 | View other entries in RefMet with this sum composition |
Exact mass | 1059.391834 (neutral) |
Table of KEGG reactions in human pathways involving 11Z-Eicosenoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R12168 | Icosenoyl-CoA + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> (8Z,11Z)-Icosadienoyl-CoA + 2 Ferricytochrome b5 + 2 H2O | icosenoyl-CoA,ferrocytochrome-b5:oxygen oxidoreductase (8,9 cis-dehydrogenating) |
Table of KEGG human pathways containing 11Z-Eicosenoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01040 | Biosynthesis of unsaturated fatty acids | 1 |
hsa01212 | Fatty acid metabolism | 1 |