RefMet Compound Details
MW structure | 2075 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 12(13)-EpOME | |
Systematic name | (+/-)-12(13)-epoxy-9Z-octadecenoic acid | |
SMILES | CCCCCC1C(C/C=C\CCCCCCCC(=O)O)O1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 296.235145 (neutral) |
Table of KEGG reactions in human pathways involving 12(13)-EpOME
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07056 | Linoleate + Oxygen + NADPH + H+ <=> 12(13)-EpOME + NADP+ + H2O | Linoleate + Oxygen + NADPH + H+ <=> 12(13)-EpOME + NADP+ + H2O |
Table of KEGG human pathways containing 12(13)-EpOME
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00591 | Linoleic acid metabolism | 1 |