RefMet Compound Details
RefMet ID | RM0153430 | |
---|---|---|
MW structure | 2643 (View MW Metabolite Database details) | |
RefMet name | 12-Oxo-ETE | |
Systematic name | 12-oxo-5Z,8Z,10E,14Z-eicosatetraenoic acid | |
SMILES | CCCCC/C=CCC(=O)/C=C/C=CC/C=CCCCC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 318.219495 (neutral) |
Table of KEGG reactions in human pathways involving 12-Oxo-ETE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R13044 | 12(R)-HPETE <=> 12-OxoETE + H2O | 12(R)-HPETE hydro-lyase |
R13045 | 12(S)-HPETE <=> 12-OxoETE + H2O | 12(S)-HPETE hydro-lyase |
Table of KEGG human pathways containing 12-Oxo-ETE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 2 |