RefMet Compound Details
MW structure | 2678 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 12R-HpETE | |
Systematic name | 12R-hydroperoxy-5Z,8Z,10E,14Z-eicosatetraenoic acid | |
SMILES | CCCCC/C=C\C[C@H](/C=C/C=C\C/C=C\CCCC(=O)O)OO Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 336.230060 (neutral) |
Table of KEGG reactions in human pathways involving 12R-HpETE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R13044 | 12(R)-HPETE <=> 12-OxoETE + H2O | 12(R)-HPETE hydro-lyase |
R07038 | Arachidonate + Oxygen <=> 12(R)-HPETE | Arachidonate: oxygen 12-oxidoreductase |
Table of KEGG human pathways containing 12R-HpETE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 2 |