RefMet Compound Details
MW structure | 2633 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 12S-HETE | |
Systematic name | 12S-hydroxy-5Z,8Z,10E,14Z-eicosatetraenoic acid | |
SMILES | CCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 320.235145 (neutral) |
Table of KEGG reactions in human pathways involving 12S-HETE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R13043 | 2 Glutathione + 12(S)-HPETE <=> Glutathione disulfide + 12(S)-HETE + H2O | glutathione:12(S)-HPETE oxidoreductase |
Table of KEGG human pathways containing 12S-HETE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 1 |