RefMet Compound Details
RefMet ID | RM0153715 | |
---|---|---|
MW structure | 2071 (View MW Metabolite Database details) | |
RefMet name | 13S-HpODE | |
Systematic name | 13S-hydroperoxy-9Z,11E-octadecadienoic acid | |
SMILES | CCCCC[C@@H](/C=C/C=CCCCCCCCC(=O)O)OO Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 312.230060 (neutral) |
Table of KEGG reactions in human pathways involving 13S-HpODE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03626 | Linoleate + Oxygen <=> (9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoic acid | Linoleate:oxygen 13-oxidoreductase |
Table of KEGG human pathways containing 13S-HpODE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00591 | Linoleic acid metabolism | 1 |