RefMet Compound Details
MW structure | 2393 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 15-Keto-PGF2alpha | |
Systematic name | 9S,11R-dihydroxy-15-oxo-5Z,13E-prostadienoic acid | |
SMILES | CCCCCC(=O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H](C[C@H]1O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 352.224975 (neutral) |
Table of KEGG reactions in human pathways involving 15-Keto-PGF2alpha
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02683 | Prostaglandin F2alpha + NAD+ <=> 15-Keto-prostaglandin F2alpha + NADH + H+ | (5Z,13E)-(15S)-9alpha,11alpha,15-Trihydroxyprosta-5,13-dienoate:NAD+ 15-oxidoreductase |
Table of KEGG human pathways containing 15-Keto-PGF2alpha
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 1 |