RefMet Compound Details
RefMet ID | RM0153355 | |
---|---|---|
MW structure | 2650 (View MW Metabolite Database details) | |
RefMet name | 15R-HETE | |
Systematic name | 15R-hydroxy-5Z,8Z,11Z,13E-eicosatetraenoic acid | |
SMILES | CCCCC[C@H](/C=C/C=CC/C=CC/C=CCCCC(=O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 320.235145 (neutral) |
Table of KEGG reactions in human pathways involving 15R-HETE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07035 | 2 Glutathione + 15(S)-HPETE <=> Glutathione disulfide + (15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoate + H2O | Glutathione: 15-HPETE oxidoreductase |
Table of KEGG human pathways containing 15R-HETE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 1 |