RefMet Compound Details
RefMet ID | RM0002266 | |
---|---|---|
MW structure | 35299 (View MW Metabolite Database details) | |
RefMet name | 16alpha-Hydroxyestrone | |
Systematic name | 3,16alpha-dihydroxy-1,3,5(10)-estratrien-17-one | |
SMILES | C[C@]12CC[C@@H]3c4ccc(cc4CC[C@H]3[C@@H]1C[C@H](C2=O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 286.156895 (neutral) |
Table of KEGG reactions in human pathways involving 16alpha-Hydroxyestrone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02356 | Estrone + H+ + Oxygen + NADPH <=> 16alpha-Hydroxyestrone + NADP+ + H2O | Estrone + H+ + Oxygen + NADPH <=> 16alpha-Hydroxyestrone + NADP+ + H2O |
R04681 | Estriol + NAD+ <=> 16alpha-Hydroxyestrone + NADH + H+ | Estriol:NAD+ 17-oxidoreductase |
R04682 | Estriol + NADP+ <=> 16alpha-Hydroxyestrone + NADPH + H+ | Estriol:NADP+ 17-oxidoreductase |
Table of KEGG human pathways containing 16alpha-Hydroxyestrone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |
hsa01100 | Metabolic pathways | 2 |
hsa00220 | Arginine biosynthesis | 1 |