RefMet Compound Details
MW structure | 35393 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 17alpha-Hydroxypregnenolone | |
Systematic name | 3beta,17alpha-dihydroxypregn-5-en-20-one | |
SMILES | CC(=O)[C@]1(CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:2;O3 | View other entries in RefMet with this sum composition |
Exact mass | 332.235145 (neutral) |
Table of KEGG reactions in human pathways involving 17alpha-Hydroxypregnenolone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04675 | 17alpha-Hydroxypregnenolone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 17alpha,21-Dihydroxypregnenolone + [Oxidized NADPH---hemoprotein reductase] + H2O | 17alpha-hydroxypregnenolone,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating) |
R03327 | 17alpha-Hydroxypregnenolone + NAD+ <=> 17alpha-Hydroxyprogesterone + NADH + H+ | 17alpha-Hydroxypregnenolone:NAD+ 3-oxidoreductase |
R03783 | Pregnenolone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 17alpha-Hydroxypregnenolone + [Oxidized NADPH---hemoprotein reductase] + H2O | pregnenolone,NADPH-hemoprotein reductase:oxygen oxidoreductase (17alpha-hydroxylating) |
R08517 | 17alpha-Hydroxypregnenolone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Dehydroepiandrosterone + Acetate + [Oxidized NADPH---hemoprotein reductase] + H2O | 17alpha-Hydroxypregnenolone,NADPH---hemoprotein reductase:oxygen oxidoreductase (17alpha-hydroxylating, acetate-releasing) |
Table of KEGG human pathways containing 17alpha-Hydroxypregnenolone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 5 |