RefMet Compound Details
MW structure | 35395 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 18-Hydroxycorticosterone | |
Systematic name | 11beta,18,21-trihydroxy-pregn-4-ene-3,20-dione | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@H](C(=O)CO)[C@]3(C[C@@H]([C@H]21)O)CO Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 362.209326 (neutral) |
Table of KEGG reactions in human pathways involving 18-Hydroxycorticosterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03262 | Corticosterone + 2 Reduced adrenal ferredoxin + Oxygen + 2 H+ <=> 18-Hydroxycorticosterone + 2 Oxidized adrenal ferredoxin + H2O | Corticosterone,reduced-adrenal-ferredoxin:oxygen oxidoreductase (18-hydroxylating) |
R03263 | 18-Hydroxycorticosterone + Reduced adrenal ferredoxin + Oxygen <=> Aldosterone + Oxidized adrenal ferredoxin + 2 H2O | 18-Hydroxycorticosterone + Reduced adrenal ferredoxin + Oxygen <=> Aldosterone + Oxidized adrenal ferredoxin + 2 H2O |
Table of KEGG human pathways containing 18-Hydroxycorticosterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |