RefMet Compound Details
MW structure | 70542 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 2,5-Dichloro-4-oxohex-2-enedioate | |
Systematic name | (E)-2,5-dichloro-4-oxo-hex-2-enedioic acid | |
SMILES | C(=C(\C(=O)O)/Cl)\C(=O)C(C(=O)O)Cl Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 225.943579 (neutral) |
Table of KEGG reactions in human pathways involving 2,5-Dichloro-4-oxohex-2-enedioate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R06835 | 2,5-Dichloro-carboxymethylenebut-2-en-4-olide + H2O <=> 2,5-Dichloro-4-oxohex-2-enedioate | 4-carboxymethylenebut-2-en-4-olide lactonohydrolase |
Table of KEGG human pathways containing 2,5-Dichloro-4-oxohex-2-enedioate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 1 |