RefMet Compound Details
MW structure | 37732 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 2-Amino-3-carboxymuconic acid semialdehyde | |
Systematic name | (2Z)-2-amino-3-[(1Z)-3-oxoprop-1-en-1-yl]but-2-enedioic acid | |
SMILES | C(=C\C(=C(/C(=O)O)\N)\C(=O)O)\C=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 185.032424 (neutral) |
Table of KEGG reactions in human pathways involving 2-Amino-3-carboxymuconic acid semialdehyde
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02665 | 3-Hydroxyanthranilate + Oxygen <=> 2-Amino-3-carboxymuconate semialdehyde | 3-Hydroxyanthranilate:oxygen 3,4-oxidoreductase (decyclizing) |
R04323 | 2-Amino-3-carboxymuconate semialdehyde <=> 2-Aminomuconate semialdehyde + CO2 | 2-Amino-3-carboxymuconate semialdehyde carboxy-lyase |
Table of KEGG human pathways containing 2-Amino-3-carboxymuconic acid semialdehyde
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 2 |