RefMet Compound Details
MW structure | 70773 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 2-Chloromaleylacetate | |
Systematic name | (E)-2-chloro-4-oxo-hex-2-enedioic acid | |
SMILES | C(=C(\C(=O)O)/Cl)\C(=O)CC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 191.982551 (neutral) |
Table of KEGG reactions in human pathways involving 2-Chloromaleylacetate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R05511 | cis-2-Chloro-4-carboxymethylenebut-2-en-1,4-olide + H2O <=> 2-Chloromaleylacetate | cis-2-Chloro-4-carboxymethylenebut-2-en-1,4-olide + H2O <=> 2-Chloromaleylacetate |
Table of KEGG human pathways containing 2-Chloromaleylacetate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 1 |