RefMet Compound Details
RefMet ID | RM0030627 | |
---|---|---|
MW structure | 35287 (View MW Metabolite Database details) | |
RefMet name | 2-Hydroxyestradiol | |
Systematic name | estra-1,3,5(10)-triene-2,3,17beta-triol | |
SMILES | C[C@]12CC[C@H]3[C@@H](CCc4cc(c(cc34)O)O)[C@@H]1CC[C@@H]2O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 18:3;O3 | View other entries in RefMet with this sum composition |
Exact mass | 288.172545 (neutral) |
Table of KEGG reactions in human pathways involving 2-Hydroxyestradiol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03088 | Estradiol-17beta + H+ + Oxygen + NADH <=> 2-Hydroxyestradiol + NAD+ + H2O | Estradiol-17beta + H+ + Oxygen + NADH <=> 2-Hydroxyestradiol + NAD+ + H2O |
R03090 | Estradiol-17beta + H+ + Oxygen + NADPH <=> 2-Hydroxyestradiol + NADP+ + H2O | Estradiol-17beta + H+ + Oxygen + NADPH <=> 2-Hydroxyestradiol + NADP+ + H2O |
R04764 | 2-Hydroxyestradiol + S-Adenosyl-L-methionine <=> 2-Methoxy-17beta-estradiol + S-Adenosyl-L-homocysteine | 2-Hydroxyestradiol + S-Adenosyl-L-methionine <=> 2-Methoxy-17beta-estradiol + S-Adenosyl-L-homocysteine |
Table of KEGG human pathways containing 2-Hydroxyestradiol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |