RefMet Compound Details
MW structure | 71697 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 2-Hydroxyfelbamate | |
Systematic name | carbamic acid (3-carbamoyloxy-2-hydroxy-2-phenyl-propyl) ester | |
SMILES | c1ccc(cc1)C(COC(=O)N)(COC(=O)N)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 254.090273 (neutral) |
Table of KEGG reactions in human pathways involving 2-Hydroxyfelbamate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08304 | Felbamate + NADPH + H+ + Oxygen <=> 2-Hydroxyfelbamate + NADP+ + H2O | Felbamate + NADPH + H+ + Oxygen <=> 2-Hydroxyfelbamate + NADP+ + H2O |
Table of KEGG human pathways containing 2-Hydroxyfelbamate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00982 | Drug metabolism - cytochrome P450 | 1 |