RefMet Compound Details
RefMet ID | RM0160053 | |
---|---|---|
MW structure | 50094 (View MW Metabolite Database details) | |
RefMet name | 2-Methylacetoacetyl-CoA | |
Alternative name | CoA 4:0;2Me,3oxo | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-{[3-({2-[(2-methyl-3-oxobutanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CC(C(=O)C)C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 5:1;O | View other entries in RefMet with this sum composition |
Exact mass | 865.151999 (neutral) |
Table of KEGG reactions in human pathways involving 2-Methylacetoacetyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00927 | Propanoyl-CoA + Acetyl-CoA <=> CoA + 2-Methylacetoacetyl-CoA | acetyl-CoA:propanoyl-CoA 2-C-acetyltransferase |
R04203 | (2S,3S)-3-Hydroxy-2-methylbutanoyl-CoA + NAD+ <=> 2-Methylacetoacetyl-CoA + NADH + H+ | (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA:NAD+ oxidoreductase |
Table of KEGG human pathways containing 2-Methylacetoacetyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 2 |