RefMet Compound Details
RefMet ID | RM0153983 | |
---|---|---|
MW structure | 50096 (View MW Metabolite Database details) | |
RefMet name | 2-Methylcrotonoyl-CoA | |
Alternative name | CoA 4:1(2Z);2Me | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[(2E)-2-methylbut-2-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | C/C=C(C)/C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 5:1 | View other entries in RefMet with this sum composition |
Exact mass | 849.157084 (neutral) |
Table of KEGG reactions in human pathways involving 2-Methylcrotonoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03172 | (S)-2-Methylbutanoyl-CoA + Acceptor <=> 2-Methylbut-2-enoyl-CoA + Reduced acceptor | (S)-2-methylbutanoyl-CoA:acceptor 2,3-oxidoreductase |
R04204 | (2S,3S)-3-Hydroxy-2-methylbutanoyl-CoA <=> 2-Methylbut-2-enoyl-CoA + H2O | (2S,3S)-3-Hydroxy-2-methylbutanoyl-CoA hydro-liase |
Table of KEGG human pathways containing 2-Methylcrotonoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 2 |