RefMet Compound Details

RefMet ID	RM0135911
MW structure	37135 (View MW Metabolite Database details)
RefMet name	2-Oxoglutaric acid
Alternative name	Oxoglutaric acid
Systematic name	2-oxopentanedioic acid
SMILES	C(CC(=O)O)C(=O)C(=O)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass	146.021525 (neutral)	Calculate m/z: (Choose adduct) [M+H]+ [M+H-H2O]+ [M.]+ [M+2H]2+ [M+3H]3+ [M+4H]4+ [M+K]+ [M+2K]2+ [M+2K-H]+ [M+Na]+ [M+2Na]2+ [M+2Na-H]+ [M+Li]+ [M+2Li]2+ [M+NH4]+ [M.CH3]+ [M+Ag]+ [M+H+CH3OH]+ [M+H+CH3CN]+ [M+H+2CH3CN]+ [M+Na+CH3CN]+ [M.NaFormate+H]+ [M.NH4Formate+H]+ [M.TMSi]+ [M.tBuDMSi]+ [M+H-Hexose]+ [M+H-EtnP]+ [M+H-SerP]+ [M-H]- [M-H-H2O]- [M-CH3]- [M-2H]2- [M-3H]3- [M-4H]4- [M+Cl]- [M+OAc]- [M+Na-2H]- [M+K-2H]- [M.Formate]- [M.NaFormate-H]- [M.NH4Formate-H]- [M.F]- [M-H-Ser]- [M.HF2]- M(neutral)    View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
Formula	C5H6O5	View other entries in RefMet with this formula
InChI	InChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)
InChIKey	KPGXRSRHYNQIFN-UHFFFAOYSA-N	View other enantiomers/diastereomers of this metabolite in RefMet
Super Class	Organic acids
Main Class	TCA acids
Sub Class	TCA acids
Pubchem CID	51
ChEBI ID	30915
Annotation level	1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving 2-Oxoglutaric acid

Rxn ID	KEGG Reaction	Enzyme
R00093	2 L-Glutamate + NAD+ <=> L-Glutamine + 2-Oxoglutarate + NADH + H+	L-glutamate:NAD+ oxidoreductase (transaminating)
R00114	2 L-Glutamate + NADP+ <=> L-Glutamine + 2-Oxoglutarate + NADPH + H+	L-glutamate:NADP+ oxidoreductase (transaminating)
R00243	L-Glutamate + NAD+ + H2O <=> 2-Oxoglutarate + Ammonia + NADH + H+	L-glutamate:NAD+ oxidoreductase (deaminating)
R00248	L-Glutamate + NADP+ + H2O <=> 2-Oxoglutarate + Ammonia + NADPH + H+	L-glutamate:NADP+ oxidoreductase (deaminating)
R00258	L-Alanine + 2-Oxoglutarate <=> Pyruvate + L-Glutamate	L-Alanine:2-oxoglutarate aminotransferase
R00267	Isocitrate + NADP+ <=> 2-Oxoglutarate + CO2 + NADPH + H+	Isocitrate:NADP+ oxidoreductase (decarboxylating)
R00268	Oxalosuccinate <=> 2-Oxoglutarate + CO2	oxalosuccinate carboxy-lyase (2-oxoglutarate-forming)
R00269	2-Oxoglutaramate + H2O <=> 2-Oxoglutarate + Ammonia	2-oxoglutaramate amidohydrolase
R00355	L-Aspartate + 2-Oxoglutarate <=> Oxaloacetate + L-Glutamate	L-Aspartate:2-oxoglutarate aminotransferase
R00709	Isocitrate + NAD+ <=> 2-Oxoglutarate + CO2 + NADH + H+	isocitrate:NAD+ oxidoreductase (decarboxylating)
R01197	2 Reduced ferredoxin + Succinyl-CoA + CO2 + 2 H+ <=> 2 Oxidized ferredoxin + 2-Oxoglutarate + CoA	2-oxoglutarate:ferredoxin oxidoreductase (decarboxylating)
R03534	2-Hydroxyglutarate + FAD <=> 2-Oxoglutarate + FADH2	2-Hydroxyglutarate:(acceptor) 2-oxidoreductase
R08549	2-Oxoglutarate + CoA + NAD+ <=> Succinyl-CoA + CO2 + NADH + H+	2-Oxoglutarate dehydrogenase complex

Table of KEGG human pathways containing 2-Oxoglutaric acid

Pathway ID	Human Pathway	# of reactions
hsa01100	Metabolic pathways	5
hsa00020	Citrate cycle (TCA cycle)	3
hsa00260	Glycine, serine and threonine metabolism	2
hsa00250	Alanine, aspartate and glutamate metabolism	2
hsa01200	Carbon metabolism	2
hsa01210	2-Oxocarboxylic acid metabolism	1
hsa00220	Arginine biosynthesis	1
hsa00480	Glutathione metabolism	1
hsa00650	Butanoate metabolism	1
hsa00910	Nitrogen metabolism	1