RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0135911
RefMet name2-Oxoglutaric acid
Alternative nameOxoglutaric acid
Systematic name2-oxopentanedioic acid
SynonymsPubChem Synonyms
Exact mass146.021525 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC5H6O5View other entries in RefMet with this formula
Molecular descriptors
Molfile37135 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)
InChIKeyKPGXRSRHYNQIFN-UHFFFAOYSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESC(CC(=O)O)C(=O)C(=O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassOrganic acids
Main ClassTCA acids
Sub ClassTCA acids
Distribution of 2-Oxoglutaric acid in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting 2-Oxoglutaric acid
External Links
Pubchem CID51
ChEBI ID30915
KEGG IDC00026
HMDB IDHMDB0000208
Chemspider ID50
MetaCyc ID2-KETOGLUTARATE
Spectral data for 2-Oxoglutaric acid standards
BMRB ID(NMR)View NMR spectra
NP-MRD ID(NMR)View NMR spectra
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving 2-Oxoglutaric acid

Rxn IDKEGG ReactionEnzyme
R00093 2 L-Glutamate + NAD+ <=> L-Glutamine + 2-Oxoglutarate + NADH + H+L-glutamate:NAD+ oxidoreductase (transaminating)
R00114 2 L-Glutamate + NADP+ <=> L-Glutamine + 2-Oxoglutarate + NADPH + H+L-glutamate:NADP+ oxidoreductase (transaminating)
R00243 L-Glutamate + NAD+ + H2O <=> 2-Oxoglutarate + Ammonia + NADH + H+L-glutamate:NAD+ oxidoreductase (deaminating)
R00248 L-Glutamate + NADP+ + H2O <=> 2-Oxoglutarate + Ammonia + NADPH + H+L-glutamate:NADP+ oxidoreductase (deaminating)
R00258 L-Alanine + 2-Oxoglutarate <=> Pyruvate + L-GlutamateL-Alanine:2-oxoglutarate aminotransferase
R00267 Isocitrate + NADP+ <=> 2-Oxoglutarate + CO2 + NADPH + H+Isocitrate:NADP+ oxidoreductase (decarboxylating)
R00268 Oxalosuccinate <=> 2-Oxoglutarate + CO2oxalosuccinate carboxy-lyase (2-oxoglutarate-forming)
R00269 2-Oxoglutaramate + H2O <=> 2-Oxoglutarate + Ammonia2-oxoglutaramate amidohydrolase
R00355 L-Aspartate + 2-Oxoglutarate <=> Oxaloacetate + L-GlutamateL-Aspartate:2-oxoglutarate aminotransferase
R00709 Isocitrate + NAD+ <=> 2-Oxoglutarate + CO2 + NADH + H+isocitrate:NAD+ oxidoreductase (decarboxylating)
R01197 2 Reduced ferredoxin + Succinyl-CoA + CO2 + 2 H+ <=> 2 Oxidized ferredoxin + 2-Oxoglutarate + CoA2-oxoglutarate:ferredoxin oxidoreductase (decarboxylating)
R03534 2-Hydroxyglutarate + FAD <=> 2-Oxoglutarate + FADH22-Hydroxyglutarate:(acceptor) 2-oxidoreductase
R08549 2-Oxoglutarate + CoA + NAD+ <=> Succinyl-CoA + CO2 + NADH + H+2-Oxoglutarate dehydrogenase complex

Table of KEGG human pathways containing 2-Oxoglutaric acid

Pathway IDHuman Pathway# of reactions
hsa01100 Metabolic pathways 5
hsa00020 Citrate cycle (TCA cycle) 3
hsa00260 Glycine, serine and threonine metabolism 2
hsa00250 Alanine, aspartate and glutamate metabolism 2
hsa01200 Carbon metabolism 2
hsa01210 2-Oxocarboxylic acid metabolism 1
hsa00220 Arginine biosynthesis 1
hsa00480 Glutathione metabolism 1
hsa00650 Butanoate metabolism 1
hsa00910 Nitrogen metabolism 1
  logo