RefMet Compound Details
RefMet ID | RM0125955 | |
---|---|---|
MW structure | 73601 (View MW Metabolite Database details) | |
RefMet name | 20S-Hydroxy-5alpha-pregnan-3-one | |
Systematic name | 20S-Hydroxy-5alpha-pregnan-3-one | |
SMILES | C[C@@H]([C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 318.255880 (neutral) |
Table of KEGG reactions in human pathways involving 20S-Hydroxy-5alpha-pregnan-3-one
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08958 | 5alpha-Pregnan-20alpha-ol-3-one + NADP+ <=> 5alpha-Pregnane-3,20-dione + NADPH + H+ | 5alpha-pregnan-20alpha-ol-3-one:NADP+ 20-oxidoreductase |
R08960 | 5alpha-Pregnan-20alpha-ol-3-one + NADPH + H+ <=> 5alpha-Pregnane-3alpha,20alpha-diol + NADP+ | 5alpha-pregnane-3alpha,20alpha-diol:NADP+ oxidoreductase (A-specific) |
Table of KEGG human pathways containing 20S-Hydroxy-5alpha-pregnan-3-one
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |