RefMet Compound Details
MW structure | 34394 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 24,25-Dihydrolanosterol | |
Systematic name | 5alpha-lanost-8-en-3beta-ol | |
SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@@H](C(C)(C)[C@@H]1CC3)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 30:1;O | View other entries in RefMet with this sum composition |
Exact mass | 428.401815 (neutral) |
Table of KEGG reactions in human pathways involving 24,25-Dihydrolanosterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03689 | Lanosterol + NADPH + H+ <=> 24,25-Dihydrolanosterol + NADP+ | lanosterol delta24-reductase |
Table of KEGG human pathways containing 24,25-Dihydrolanosterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 1 |