RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0135793 | |
---|---|---|
RefMet name | 25-Hydroxyvitamin D3 | |
Systematic name | (5Z,7E)-(3S)-9,10-seco-5,7,10(19)-cholestatriene-3,25-diol | |
Synonyms | PubChem Synonyms | |
Exact mass | 400.334130 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C27H44O2 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 35795 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C27H44O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h11-12,20,23-25,28-29H,1 ,6-10,13-18H2,2-5H3/b21-11+,22-12-/t20-,23+,24-,25+,27-/m1/s1 | |
InChIKey | JWUBBDSIWDLEOM-DTOXIADCSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | C=C1CC[C@@H](C/C/1=C/C=C/1\CCC[C@]2(C)[C@H](CC[C@@H]12)[C@H](C)CCCC(C)(C)O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Sterol Lipids | |
Main Class | Secosterols | |
Sub Class | Vitamin D3 | |
Distribution of 25-Hydroxyvitamin D3 in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting 25-Hydroxyvitamin D3 | |
External Links | ||
Pubchem CID | 5283731 | |
LIPID MAPS | LMST03020246 | |
ChEBI ID | 17933 | |
KEGG ID | C01561 | |
HMDB ID | HMDB0003550 | |
Chemspider ID | 4446820 | |
MetaCyc ID | CALCIDIOL | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving 25-Hydroxyvitamin D3
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03610 | Calcidiol + 2 Reduced adrenal ferredoxin + 2 H+ + Oxygen <=> Calcitriol + Oxidized adrenal ferredoxin + H2O | calcidiol,adrenodoxin:oxygen oxidoreductase (1-hydroxylating) |
R03611 | Calcidiol + [Oxidized NADPH---hemoprotein reductase] + H2O <=> Vitamin D3 + [Reduced NADPH---hemoprotein reductase] + Oxygen | calciol,NADPH-hemoprotein reductase:oxygen oxidoreductase (25-hydroxylating) |
R09516 | Calcidiol + 2 Reduced adrenal ferredoxin + 2 H+ + Oxygen <=> Secalciferol + 2 Oxidized adrenal ferredoxin + H2O | calcidiol,adrenodoxin:oxygen oxidoreductase (24-hydroxylating) |
R11458 | Vitamin D3 + Oxygen + 2 Reduced ferredoxin + 2 H+ <=> Calcidiol + 2 Oxidized ferredoxin + H2O | calciol,ferredoxin:oxygen oxidoreductase (1,25-hydroxylating) |
R11459 | Calcidiol + Oxygen + 2 Reduced ferredoxin + 2 H+ <=> Calcitriol + 2 Oxidized ferredoxin + H2O | Calcidiol + Oxygen + 2 Reduced ferredoxin + 2 H+ <=> Calcitriol + 2 Oxidized ferredoxin + H2O |
Table of KEGG human pathways containing 25-Hydroxyvitamin D3
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 3 |
hsa01100 | Metabolic pathways | 2 |