RefMet Compound Details
RefMet ID | RM0155820 | |
---|---|---|
MW structure | 53542 (View MW Metabolite Database details) | |
RefMet name | 2E-Decenoyl-CoA | |
Alternative name | CoA 12:1(2E) | |
Systematic name | 3'-phosphoadenosine 5'-[3-(4-{[3-({2-[(2E)-dec-2-noylsulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl) dihydrogen diphosphate] | |
SMILES | CCCCCCC/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 10:1 | View other entries in RefMet with this sum composition |
Exact mass | 919.235334 (neutral) |
Table of KEGG reactions in human pathways involving 2E-Decenoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04744 | (S)-Hydroxydecanoyl-CoA <=> trans-Dec-2-enoyl-CoA + H2O | (S)-Hydroxydecanoyl-CoA hydro-lyase |
R04753 | Decanoyl-CoA + NADP+ <=> trans-Dec-2-enoyl-CoA + NADPH + H+ | trans-Dec-2-enoyl-CoA reductase |
R04754 | Decanoyl-CoA + FAD <=> trans-Dec-2-enoyl-CoA + FADH2 | decanoyl-CoA:electron-transfer flavoprotein 2,3-oxidoreductase |
Table of KEGG human pathways containing 2E-Decenoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01212 | Fatty acid metabolism | 3 |
hsa00062 | Fatty acid elongation | 2 |
hsa00071 | Fatty acid degradation | 2 |