RefMet Compound Details
RefMet ID | RM0155821 | |
---|---|---|
MW structure | 51820 (View MW Metabolite Database details) | |
RefMet name | 2E-Hexenoyl-CoA | |
Alternative name | CoA 6:1(2E) | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[(2E)-hex-2-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CCC/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 6:1 | View other entries in RefMet with this sum composition |
Exact mass | 863.172734 (neutral) |
Table of KEGG reactions in human pathways involving 2E-Hexenoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04749 | (S)-Hydroxyhexanoyl-CoA <=> trans-Hex-2-enoyl-CoA + H2O | (S)-Hydroxyhexanoyl-CoA hydro-lyase |
R04751 | Hexanoyl-CoA + FAD <=> trans-Hex-2-enoyl-CoA + FADH2 | hexanoyl-CoA:electron-transfer flavoprotein 2,3-oxidoreductase |
R06985 | trans-Hex-2-enoyl-CoA + NADPH + H+ <=> Hexanoyl-CoA + NADP+ | trans-Hex-2-enoyl-CoA reductase |
Table of KEGG human pathways containing 2E-Hexenoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01212 | Fatty acid metabolism | 3 |
hsa00062 | Fatty acid elongation | 2 |
hsa00071 | Fatty acid degradation | 2 |