RefMet Compound Details
MW structure | 37722 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 3',5' cyclic GMP | |
Systematic name | 9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-hexahydro-1,3,5,2$l^{5}-furo[3,2-d][1,3,2$l^{5}]dioxaphosphinin-6-yl]-2-amino-6,9-dihydro-1H-purin-6-one | |
SMILES | C1[C@@H]2[C@H]([C@H]([C@H](n3cnc4c3nc(N)[nH]c4=O)O2)O)OP(=O)(O)O1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 345.047438 (neutral) |
Table of KEGG reactions in human pathways involving 3'',5'' cyclic GMP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01234 | 3',5'-Cyclic GMP + H2O <=> GMP | Guanosine 3',5'-cyclic phosphate 5'-nucleotidohydrolase |
R00434 | GTP <=> 3',5'-Cyclic GMP + Diphosphate | GTP diphosphate-lyase (cyclizing |
Table of KEGG human pathways containing 3'',5'' cyclic GMP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 2 |