RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0136242 | |
---|---|---|
RefMet name | 3,4-Dihydroxyphenylacetaldehyde | |
Systematic name | 2-(3,4-dihydroxyphenyl)acetaldehyde | |
Synonyms | PubChem Synonyms | |
Exact mass | 152.047345 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C8H8O3 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 38395 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C8H8O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,4-5,10-11H,3H2 | |
InChIKey | IADQVXRMSNIUEL-UHFFFAOYSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | c1cc(c(cc1CC=O)O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Organic acids | |
Main Class | Phenylpropanoids | |
Sub Class | Cinnamic acids | |
Distribution of 3,4-Dihydroxyphenylacetaldehyde in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting 3,4-Dihydroxyphenylacetaldehyde | |
External Links | ||
Pubchem CID | 119219 | |
ChEBI ID | 27978 | |
KEGG ID | C04043 | |
HMDB ID | HMDB0003791 | |
Chemspider ID | 106504 | |
MetaCyc ID | 34-DIHYDROXYPHENYLACETALDEHYDE | |
EPA CompTox | DTXCID40128171 | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving 3,4-Dihydroxyphenylacetaldehyde
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03300 | 3,4-Dihydroxyphenylacetaldehyde + NAD+ + H2O <=> 3,4-Dihydroxyphenylacetate + NADH + H+ | 3,4-Dihydroxyphenylacetaldehyde:NAD+ oxidoreductase |
R03302 | 3,4-Dihydroxyphenylacetaldehyde + NADP+ + H2O <=> 3,4-Dihydroxyphenylacetate + NADPH + H+ | 3,4-Dihydroxyphenylacetaldehyde:NADP+ oxidoreductase |
R04300 | Dopamine + H2O + Oxygen <=> 3,4-Dihydroxyphenylacetaldehyde + Ammonia + Hydrogen peroxide | 4-(2-Aminoethyl)-1,2-benzenediol:oxygen oxidoreductase(deaminating)(flavin-containing) |
Table of KEGG human pathways containing 3,4-Dihydroxyphenylacetaldehyde
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00350 | Tyrosine metabolism | 3 |
hsa01100 | Metabolic pathways | 2 |