RefMet Compound Details
RefMet ID | RM0162671 | |
---|---|---|
MW structure | 37962 (View MW Metabolite Database details) | |
RefMet name | 3,7-Dimethyluric acid | |
Systematic name | 3,7-dimethyl-2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione | |
SMILES | Cn1c2c([nH]c1=O)n(C)c(=O)[nH]c2=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 196.059641 (neutral) |
Table of KEGG reactions in human pathways involving 3,7-Dimethyluric acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07978 | Theobromine + H2O + Oxygen <=> 3,7-Dimethyluric acid + Hydrogen peroxide | 3,7-dimethylxanthine:oxygen oxidoreductase |
Table of KEGG human pathways containing 3,7-Dimethyluric acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00232 | Caffeine metabolism | 1 |