RefMet Compound Details
RefMet ID | RM0154002 | |
---|---|---|
MW structure | 65412 (View MW Metabolite Database details) | |
RefMet name | 3-Hydroxyadipyl-CoA | |
Alternative name | CoA DC6:0;3OH | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(5-carboxy-3-hydroxypentanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)[C@H](C(=O)NCCC(=O)NCCSC(=O)CC(CCC(=O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 6:1;O3 | View other entries in RefMet with this sum composition |
Exact mass | 911.157479 (neutral) |
Table of KEGG reactions in human pathways involving 3-Hydroxyadipyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R06941 | (3S)-3-Hydroxyadipyl-CoA + NAD+ <=> 3-Oxoadipyl-CoA + NADH + H+ | (S)-3-hydroxyacyl-CoA:NAD+ oxidoreductase |
R06942 | 5-Carboxy-2-pentenoyl-CoA + H2O <=> (3S)-3-Hydroxyadipyl-CoA | (3S)-3-hydroxyacyl-CoA hydro-lyase |
Table of KEGG human pathways containing 3-Hydroxyadipyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 2 |